www.apchemsolutions.com
Lecture 37
Organic Chemistry
Tutorial
Write balanced chemical equations for the reactions in question 1 through 4.
1) Ethene combusts in the presence if oxygen gas.
C2H4(g) + 3 O2(g) Æ 2 CO2(g) + 2 H2O(l)
2) Decyne combusts in air.
2 C10H18(g) + 29 O2(g) Æ 20 CO2(g) + 18 H2O(l)
3) Dimethyl ether combusts in air.
CH3OCH3 (g) + 3 O2(g) Æ 2 CO2(g) + 3 H2O(l)
4) Equal volumes of 1.0 M heptanoic acid and 1.0 M lithium hydroxide are mixed.
CH3CH2CH2CH2CH2CH2COOH(aq) + OH-(aq) Æ CH3CH2CH2CH2CH2CH2COO-(aq) + H3O+(aq)
5) Draw the complete structural formula for each of the following: (show all bonds
and atoms)
a. 2- methyl-4-ethylheptane
b. methyl-benzene
© 2009, 2008 AP Chem Solutions. All rights reserved.